C19H22BrNO3 — CID 11773739
(1S,2R,4S,5S,6S,8R,9S,10R,11S)-5-bromo-N,N-dimethyl-16-oxo-3-oxahexacyclo[9.6.0.01,14.02,9.04,8.06,10]heptadec-14-ene-12-carboxamide (PubChem CID 11773739) has the molecular formula C19H22BrNO3 and a molecular weight of 392.29 g/mol. Its IUPAC name is (1S,2R,4S,5S,6S,8R,9S,10R,11S)-5-bromo-N,N-dimethyl-16-oxo-3-oxahexacyclo[9.6.0.01,14.02,9.04,8.06,10]heptadec-14-ene-12-carboxamide.
| Compound Name | (1S,2R,4S,5S,6S,8R,9S,10R,11S)-5-bromo-N,N-dimethyl-16-oxo-3-oxahexacyclo[9.6.0.01,14.02,9.04,8.06,10]heptadec-14-ene-12-carboxamide |
|---|---|
| PubChem CID | 11773739 |
| Molecular Formula | C19H22BrNO3 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (1S,2R,4S,5S,6S,8R,9S,10R,11S)-5-bromo-N,N-dimethyl-16-oxo-3-oxahexacyclo[9.6.0.01,14.02,9.04,8.06,10]heptadec-14-ene-12-carboxamide |
| SMILES | CN(C)C(=O)C1CC2=CC(=O)C[C@@]23[C@@H]2O[C@@H]4[C@@H](Br)[C@H]5C[C@@H]4[C@@H]2[C@H]5[C@@H]13 |
| InChI | InChI=1S/C19H22BrNO3/c1-21(2)18(23)11-4-7-3-8(22)6-19(7)14(11)12-9-5-10-13(12)17(19)24-16(10)15(9)20/h3,9-17H,4-6H2,1-2H3/t9-,10+,11?,12-,13+,14+,15-,16-,17+,19+/m0/s1 |
| InChIKey | KYXBMUFFXRCTCE-WSJDHMLNSA-N |
| XLogP | 2.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|