C19H18Cl2N4O2 — CID 11774091
4-(3,4-dichlorophenyl)-4-hydroxy-N-(1H-indazol-3-yl)piperidine-1-carboxamide (PubChem CID 11774091) has the molecular formula C19H18Cl2N4O2 and a molecular weight of 405.29 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-4-hydroxy-N-(1H-indazol-3-yl)piperidine-1-carboxamide.
| Compound Name | 4-(3,4-dichlorophenyl)-4-hydroxy-N-(1H-indazol-3-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 11774091 |
| Molecular Formula | C19H18Cl2N4O2 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-4-hydroxy-N-(1H-indazol-3-yl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1n[nH]c2ccccc12)N1CCC(O)(c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H18Cl2N4O2/c20-14-6-5-12(11-15(14)21)19(27)7-9-25(10-8-19)18(26)22-17-13-3-1-2-4-16(13)23-24-17/h1-6,11,27H,7-10H2,(H2,22,23,24,26) |
| InChIKey | DYYUZASEUPBQSO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |