About N-(4-chlorophenyl)-N,3-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide
N-(4-chlorophenyl)-N,3-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide (PubChem CID 11774199) has the molecular formula C23H25ClN4O
and a molecular weight of 408.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N,3-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-N,3-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide |
| PubChem CID | 11774199 |
| Molecular Formula | C23H25ClN4O |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | N-(4-chlorophenyl)-N,3-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide |
| SMILES | Cc1c(N2CCN(C)CC2)nc2ccccc2c1C(=O)N(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H25ClN4O/c1-16-21(23(29)27(3)18-10-8-17(24)9-11-18)19-6-4-5-7-20(19)25-22(16)28-14-12-26(2)13-15-28/h4-11H,12-15H2,1-3H3 |
| InChIKey | MOFHAGFIUWSZCB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-chlorophenyl)-N,3-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-N,3-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide?
The IUPAC name of N-(4-chlorophenyl)-N,3-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide (CID 11774199) is N-(4-chlorophenyl)-N,3-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide.
What is the SMILES notation for N-(4-chlorophenyl)-N,3-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide?
The canonical SMILES for N-(4-chlorophenyl)-N,3-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide is Cc1c(N2CCN(C)CC2)nc2ccccc2c1C(=O)N(C)c1ccc(Cl)cc1.
What is the InChIKey of N-(4-chlorophenyl)-N,3-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide?
The InChIKey is MOFHAGFIUWSZCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25ClN4O/c1-16-21(23(29)27(3)18-10-8-17(24)9-11-18)19-6-4-5-7-20(19)25-22(16)28-14-12-26(2)13-15-28/h4-11H,12-15H2,1-3H3.
What are the key properties of N-(4-chlorophenyl)-N,3-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide?
N-(4-chlorophenyl)-N,3-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide has a molecular weight of 408.93 g/mol, XLogP of 4.23, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-N,3-dimethyl-2-(4-methylpiperazin-1-yl)quinoline-4-carboxamide is sourced from PubChem (CID 11774199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).