C17H13F3N4O3S — CID 11774222
3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzenesulfonamide (PubChem CID 11774222) has the molecular formula C17H13F3N4O3S and a molecular weight of 410.38 g/mol. Its IUPAC name is 3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzenesulfonamide.
| Compound Name | 3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 11774222 |
| Molecular Formula | C17H13F3N4O3S |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)ncn2)c1 |
| InChI | InChI=1S/C17H13F3N4O3S/c18-17(19,20)27-13-6-4-12(5-7-13)24-16-9-15(22-10-23-16)11-2-1-3-14(8-11)28(21,25)26/h1-10H,(H2,21,25,26)(H,22,23,24) |
| InChIKey | VFKWROLEOAAKOY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |