C23H19FN4OS — CID 11774422
N-(2-fluoro-4-methylphenyl)-4-methyl-3-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]benzamide (PubChem CID 11774422) has the molecular formula C23H19FN4OS and a molecular weight of 418.50 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-4-methyl-3-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]benzamide.
| Compound Name | N-(2-fluoro-4-methylphenyl)-4-methyl-3-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 11774422 |
| Molecular Formula | C23H19FN4OS |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-4-methyl-3-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(C)c(Nc3nc(-c4ccncc4)cs3)c2)c(F)c1 |
| InChI | InChI=1S/C23H19FN4OS/c1-14-3-6-19(18(24)11-14)26-22(29)17-5-4-15(2)20(12-17)27-23-28-21(13-30-23)16-7-9-25-10-8-16/h3-13H,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | KEGNSSGMGGDGPU-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazole_amine_M(1)', 'substructure': 'N/A'} |
|---|