C26H30O5 — CID 11774541
(2S,3R,4R)-2,3,5-tris(phenylmethoxy)pentane-1,4-diol (PubChem CID 11774541) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is (2S,3R,4R)-2,3,5-tris(phenylmethoxy)pentane-1,4-diol.
| Compound Name | (2S,3R,4R)-2,3,5-tris(phenylmethoxy)pentane-1,4-diol |
|---|---|
| PubChem CID | 11774541 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | (2S,3R,4R)-2,3,5-tris(phenylmethoxy)pentane-1,4-diol |
| SMILES | OC[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C26H30O5/c27-16-25(30-18-22-12-6-2-7-13-22)26(31-19-23-14-8-3-9-15-23)24(28)20-29-17-21-10-4-1-5-11-21/h1-15,24-28H,16-20H2/t24-,25+,26-/m1/s1 |
| InChIKey | NJEJAQAZBITKET-UODIDJSMSA-N |
| XLogP | 3.73 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |