C24H44O4Si — CID 11774600
(12Z,15Z)-9-[tert-butyl(dimethyl)silyl]oxy-10-oxooctadeca-12,15-dienoic acid (PubChem CID 11774600) has the molecular formula C24H44O4Si and a molecular weight of 424.70 g/mol. Its IUPAC name is (12Z,15Z)-9-[tert-butyl(dimethyl)silyl]oxy-10-oxooctadeca-12,15-dienoic acid.
| Compound Name | (12Z,15Z)-9-[tert-butyl(dimethyl)silyl]oxy-10-oxooctadeca-12,15-dienoic acid |
|---|---|
| PubChem CID | 11774600 |
| Molecular Formula | C24H44O4Si |
| Molecular Weight | 424.70 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | (12Z,15Z)-9-[tert-butyl(dimethyl)silyl]oxy-10-oxooctadeca-12,15-dienoic acid |
| SMILES | CC/C=C\C/C=C\CC(=O)C(CCCCCCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H44O4Si/c1-7-8-9-10-12-15-18-21(25)22(28-29(5,6)24(2,3)4)19-16-13-11-14-17-20-23(26)27/h8-9,12,15,22H,7,10-11,13-14,16-20H2,1-6H3,(H,26,27)/b9-8-,15-12- |
| InChIKey | SBDGRFCZRGINLJ-FVCILMKBSA-N |
| XLogP | 7.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.70 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|