C22H27Cl3N2 — CID 11774625
2-(trichloromethyl)-1,3-bis(2,4,6-trimethylphenyl)imidazolidine (PubChem CID 11774625) has the molecular formula C22H27Cl3N2 and a molecular weight of 425.83 g/mol. Its IUPAC name is 2-(trichloromethyl)-1,3-bis(2,4,6-trimethylphenyl)imidazolidine.
| Compound Name | 2-(trichloromethyl)-1,3-bis(2,4,6-trimethylphenyl)imidazolidine |
|---|---|
| PubChem CID | 11774625 |
| Molecular Formula | C22H27Cl3N2 |
| Molecular Weight | 425.83 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-(trichloromethyl)-1,3-bis(2,4,6-trimethylphenyl)imidazolidine |
| SMILES | Cc1cc(C)c(N2CCN(c3c(C)cc(C)cc3C)C2C(Cl)(Cl)Cl)c(C)c1 |
| InChI | InChI=1S/C22H27Cl3N2/c1-13-9-15(3)19(16(4)10-13)26-7-8-27(21(26)22(23,24)25)20-17(5)11-14(2)12-18(20)6/h9-12,21H,7-8H2,1-6H3 |
| InChIKey | BQPZMDZPDASSPW-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.83 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|