C26H22FN3O3 — CID 1177464
(5R,10bR)-5'-ethyl-2-(4-fluorophenyl)-7-methoxyspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,3'-1H-indole]-2'-one (PubChem CID 1177464) has the molecular formula C26H22FN3O3 and a molecular weight of 443.48 g/mol. Its IUPAC name is (5R,10bR)-5'-ethyl-2-(4-fluorophenyl)-7-methoxyspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,3'-1H-indole]-2'-one.
| Compound Name | (5R,10bR)-5'-ethyl-2-(4-fluorophenyl)-7-methoxyspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,3'-1H-indole]-2'-one |
|---|---|
| PubChem CID | 1177464 |
| Molecular Formula | C26H22FN3O3 |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | (5R,10bR)-5'-ethyl-2-(4-fluorophenyl)-7-methoxyspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,3'-1H-indole]-2'-one |
| SMILES | CCc1ccc2c(c1)[C@@]1(Oc3c(OC)cccc3[C@H]3CC(c4ccc(F)cc4)=NN31)C(=O)N2 |
| InChI | InChI=1S/C26H22FN3O3/c1-3-15-7-12-20-19(13-15)26(25(31)28-20)30-22(18-5-4-6-23(32-2)24(18)33-26)14-21(29-30)16-8-10-17(27)11-9-16/h4-13,22H,3,14H2,1-2H3,(H,28,31)/t22-,26-/m1/s1 |
| InChIKey | STOVDFZFUJDFKB-ATIYNZHBSA-N |
| XLogP | 4.75 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |