C22H38O6Si — CID 11774641
(Z)-3-[(2S,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethynyl-6-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl]-2-(methoxymethoxy)prop-2-en-1-ol (PubChem CID 11774641) has the molecular formula C22H38O6Si and a molecular weight of 426.63 g/mol. Its IUPAC name is (Z)-3-[(2S,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethynyl-6-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl]-2-(methoxymethoxy)prop-2-en-1-ol.
| Compound Name | (Z)-3-[(2S,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethynyl-6-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl]-2-(methoxymethoxy)prop-2-en-1-ol |
|---|---|
| PubChem CID | 11774641 |
| Molecular Formula | C22H38O6Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (Z)-3-[(2S,3S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethynyl-6-propan-2-yloxy-3,6-dihydro-2H-pyran-3-yl]-2-(methoxymethoxy)prop-2-en-1-ol |
| SMILES | C#CC1=C[C@@H](OC(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1/C=C(/CO)OCOC |
| InChI | InChI=1S/C22H38O6Si/c1-10-17-11-21(27-16(2)3)28-20(14-26-29(8,9)22(4,5)6)19(17)12-18(13-23)25-15-24-7/h1,11-12,16,19-21,23H,13-15H2,2-9H3/b18-12-/t19-,20+,21-/m0/s1 |
| InChIKey | AGAFJUHKLIFODX-SMAOZERFSA-N |
| XLogP | 3.83 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|