C22H24N2O5S — CID 11774686
11,14,17,20,23-pentaoxa-30-thia-3,4-diazatetracyclo[22.3.1.12,5.16,10]triaconta-1(28),2,4,6(29),7,9,24,26-octaene (PubChem CID 11774686) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is 11,14,17,20,23-pentaoxa-30-thia-3,4-diazatetracyclo[22.3.1.12,5.16,10]triaconta-1(28),2,4,6(29),7,9,24,26-octaene.
| Compound Name | 11,14,17,20,23-pentaoxa-30-thia-3,4-diazatetracyclo[22.3.1.12,5.16,10]triaconta-1(28),2,4,6(29),7,9,24,26-octaene |
|---|---|
| PubChem CID | 11774686 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 11,14,17,20,23-pentaoxa-30-thia-3,4-diazatetracyclo[22.3.1.12,5.16,10]triaconta-1(28),2,4,6(29),7,9,24,26-octaene |
| SMILES | c1cc2cc(c1)-c1nnc(s1)-c1cccc(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C22H24N2O5S/c1-3-17-15-19(5-1)28-13-11-26-9-7-25-8-10-27-12-14-29-20-6-2-4-18(16-20)22-24-23-21(17)30-22/h1-6,15-16H,7-14H2 |
| InChIKey | WLAUBFIALUAJKO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |