C25H31N5O2 — CID 11774853
1-ethyl-3-[2-methoxy-4-[5-methyl-6-(1-phenylbutylamino)pyrazin-2-yl]phenyl]urea (PubChem CID 11774853) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 1-ethyl-3-[2-methoxy-4-[5-methyl-6-(1-phenylbutylamino)pyrazin-2-yl]phenyl]urea.
| Compound Name | 1-ethyl-3-[2-methoxy-4-[5-methyl-6-(1-phenylbutylamino)pyrazin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 11774853 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 1-ethyl-3-[2-methoxy-4-[5-methyl-6-(1-phenylbutylamino)pyrazin-2-yl]phenyl]urea |
| SMILES | CCCC(Nc1nc(-c2ccc(NC(=O)NCC)c(OC)c2)cnc1C)c1ccccc1 |
| InChI | InChI=1S/C25H31N5O2/c1-5-10-20(18-11-8-7-9-12-18)28-24-17(3)27-16-22(29-24)19-13-14-21(23(15-19)32-4)30-25(31)26-6-2/h7-9,11-16,20H,5-6,10H2,1-4H3,(H,28,29)(H2,26,30,31) |
| InChIKey | NBIHRJMKLLFBCR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |