About N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-2-methoxybenzamide
N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-2-methoxybenzamide (PubChem CID 11774865) has the molecular formula C22H25Cl2N3O2
and a molecular weight of 434.37 g/mol. Its IUPAC name is N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-2-methoxybenzamide.
Molecular Properties
| Compound Name | N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-2-methoxybenzamide |
| PubChem CID | 11774865 |
| Molecular Formula | C22H25Cl2N3O2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC/C=C/CN1CCN(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C22H25Cl2N3O2/c1-29-20-10-3-2-7-17(20)22(28)25-11-4-5-12-26-13-15-27(16-14-26)19-9-6-8-18(23)21(19)24/h2-10H,11-16H2,1H3,(H,25,28)/b5-4+ |
| InChIKey | BHCGEYUCUMFGQX-SNAWJCMRSA-N |
| XLogP | 4.11 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-2-methoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-2-methoxybenzamide?
The IUPAC name of N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-2-methoxybenzamide (CID 11774865) is N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-2-methoxybenzamide.
What is the SMILES notation for N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-2-methoxybenzamide?
The canonical SMILES for N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-2-methoxybenzamide is COc1ccccc1C(=O)NC/C=C/CN1CCN(c2cccc(Cl)c2Cl)CC1.
What is the InChIKey of N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-2-methoxybenzamide?
The InChIKey is BHCGEYUCUMFGQX-SNAWJCMRSA-N. The full InChI is InChI=1S/C22H25Cl2N3O2/c1-29-20-10-3-2-7-17(20)22(28)25-11-4-5-12-26-13-15-27(16-14-26)19-9-6-8-18(23)21(19)24/h2-10H,11-16H2,1H3,(H,25,28)/b5-4+.
What are the key properties of N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-2-methoxybenzamide?
N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-2-methoxybenzamide has a molecular weight of 434.37 g/mol, XLogP of 4.11, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-4-[4-(2,3-dichlorophenyl)piperazin-1-yl]but-2-enyl]-2-methoxybenzamide is sourced from PubChem (CID 11774865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).