About methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-diynoate
methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-diynoate (PubChem CID 11774944) has the molecular formula C25H44O4Si
and a molecular weight of 436.71 g/mol. Its IUPAC name is methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-diynoate.
Molecular Properties
| Compound Name | methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-diynoate |
| PubChem CID | 11774944 |
| Molecular Formula | C25H44O4Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-diynoate |
| SMILES | CCC#CCC#CCC(O)C(CCCCCCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44O4Si/c1-8-9-10-11-13-16-19-22(26)23(29-30(6,7)25(2,3)4)20-17-14-12-15-18-21-24(27)28-5/h22-23,26H,8,11-12,14-15,17-21H2,1-7H3 |
| InChIKey | WJTZAFAIQUKEKM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-diynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-diynoate?
The IUPAC name of methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-diynoate (CID 11774944) is methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-diynoate.
What is the SMILES notation for methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-diynoate?
The canonical SMILES for methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-diynoate is CCC#CCC#CCC(O)C(CCCCCCCC(=O)OC)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-diynoate?
The InChIKey is WJTZAFAIQUKEKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H44O4Si/c1-8-9-10-11-13-16-19-22(26)23(29-30(6,7)25(2,3)4)20-17-14-12-15-18-21-24(27)28-5/h22-23,26H,8,11-12,14-15,17-21H2,1-7H3.
What are the key properties of methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-diynoate?
methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-diynoate has a molecular weight of 436.71 g/mol, XLogP of 5.84, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-diynoate is sourced from PubChem (CID 11774944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).