C24H44O5Si — CID 11775045
(2S)-2-[(4S,5S)-2,2-dimethyl-5-[(S)-[(2S,3R)-2-methyl-3-[(Z,2S)-pent-3-en-2-yl]oxiran-2-yl]-triethylsilyloxymethyl]-1,3-dioxan-4-yl]propanal (PubChem CID 11775045) has the molecular formula C24H44O5Si and a molecular weight of 440.70 g/mol. Its IUPAC name is (2S)-2-[(4S,5S)-2,2-dimethyl-5-[(S)-[(2S,3R)-2-methyl-3-[(Z,2S)-pent-3-en-2-yl]oxiran-2-yl]-triethylsilyloxymethyl]-1,3-dioxan-4-yl]propanal.
| Compound Name | (2S)-2-[(4S,5S)-2,2-dimethyl-5-[(S)-[(2S,3R)-2-methyl-3-[(Z,2S)-pent-3-en-2-yl]oxiran-2-yl]-triethylsilyloxymethyl]-1,3-dioxan-4-yl]propanal |
|---|---|
| PubChem CID | 11775045 |
| Molecular Formula | C24H44O5Si |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | (2S)-2-[(4S,5S)-2,2-dimethyl-5-[(S)-[(2S,3R)-2-methyl-3-[(Z,2S)-pent-3-en-2-yl]oxiran-2-yl]-triethylsilyloxymethyl]-1,3-dioxan-4-yl]propanal |
| SMILES | C/C=C\[C@H](C)[C@H]1O[C@]1(C)[C@@H](O[Si](CC)(CC)CC)[C@H]1COC(C)(C)O[C@@H]1C(C)C=O |
| InChI | InChI=1S/C24H44O5Si/c1-10-14-17(5)21-24(9,28-21)22(29-30(11-2,12-3)13-4)19-16-26-23(7,8)27-20(19)18(6)15-25/h10,14-15,17-22H,11-13,16H2,1-9H3/b14-10-/t17-,18?,19-,20+,21+,22-,24-/m0/s1 |
| InChIKey | PPHKFYCOIOEELB-YZXXHQPNSA-N |
| XLogP | 5.35 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|