C23H44O4Si2 — CID 11775047
(Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-2,2-dimethyl-5-(3-trimethylsilylprop-2-ynyl)-1,3-dioxolan-4-yl]hex-2-en-1-ol (PubChem CID 11775047) has the molecular formula C23H44O4Si2 and a molecular weight of 440.77 g/mol. Its IUPAC name is (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-2,2-dimethyl-5-(3-trimethylsilylprop-2-ynyl)-1,3-dioxolan-4-yl]hex-2-en-1-ol.
| Compound Name | (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-2,2-dimethyl-5-(3-trimethylsilylprop-2-ynyl)-1,3-dioxolan-4-yl]hex-2-en-1-ol |
|---|---|
| PubChem CID | 11775047 |
| Molecular Formula | C23H44O4Si2 |
| Molecular Weight | 440.77 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | (Z,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-2,2-dimethyl-5-(3-trimethylsilylprop-2-ynyl)-1,3-dioxolan-4-yl]hex-2-en-1-ol |
| SMILES | C[C@H](C/C=C\C(O)[C@H]1OC(C)(C)O[C@H]1CC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O4Si2/c1-18(27-29(10,11)22(2,3)4)14-12-15-19(24)21-20(25-23(5,6)26-21)16-13-17-28(7,8)9/h12,15,18-21,24H,14,16H2,1-11H3/b15-12-/t18-,19?,20+,21-/m1/s1 |
| InChIKey | CCWUSAVMYPRQLQ-PIVKVPAZSA-N |
| XLogP | 5.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.77 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|