C23H24N6S — CID 11775354
3-[4-[4-(2,1,3-benzothiadiazol-4-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile (PubChem CID 11775354) has the molecular formula C23H24N6S and a molecular weight of 416.55 g/mol. Its IUPAC name is 3-[4-[4-(2,1,3-benzothiadiazol-4-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile.
| Compound Name | 3-[4-[4-(2,1,3-benzothiadiazol-4-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 11775354 |
| Molecular Formula | C23H24N6S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 3-[4-[4-(2,1,3-benzothiadiazol-4-yl)piperazin-1-yl]butyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CCCCN3CCN(c4cccc5nsnc45)CC3)c2c1 |
| InChI | InChI=1S/C23H24N6S/c24-15-17-7-8-20-19(14-17)18(16-25-20)4-1-2-9-28-10-12-29(13-11-28)22-6-3-5-21-23(22)27-30-26-21/h3,5-8,14,16,25H,1-2,4,9-13H2 |
| InChIKey | WNFZGOUONAMKNP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|