C24H17FN4O5 — CID 11775542
8-amino-18-(dimethylamino)-19-fluoro-22-oxo-5,16-dioxa-1,12-diazahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-2(15),3,6(11),7,9,13,17(25),18,20,23-decaene-23-carboxylic acid (PubChem CID 11775542) has the molecular formula C24H17FN4O5 and a molecular weight of 460.42 g/mol. Its IUPAC name is 8-amino-18-(dimethylamino)-19-fluoro-22-oxo-5,16-dioxa-1,12-diazahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-2(15),3,6(11),7,9,13,17(25),18,20,23-decaene-23-carboxylic acid.
| Compound Name | 8-amino-18-(dimethylamino)-19-fluoro-22-oxo-5,16-dioxa-1,12-diazahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-2(15),3,6(11),7,9,13,17(25),18,20,23-decaene-23-carboxylic acid |
|---|---|
| PubChem CID | 11775542 |
| Molecular Formula | C24H17FN4O5 |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 8-amino-18-(dimethylamino)-19-fluoro-22-oxo-5,16-dioxa-1,12-diazahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-2(15),3,6(11),7,9,13,17(25),18,20,23-decaene-23-carboxylic acid |
| SMILES | CN(C)c1c(F)cc2c(=O)c(C(=O)O)cn3c4cc5oc6cc(N)ccc6[nH]c5cc4oc1c23 |
| InChI | InChI=1S/C24H17FN4O5/c1-28(2)21-13(25)6-11-20-23(21)34-19-7-15-18(33-17-5-10(26)3-4-14(17)27-15)8-16(19)29(20)9-12(22(11)30)24(31)32/h3-9,27H,26H2,1-2H3,(H,31,32) |
| InChIKey | REJMSMHPBRICMU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 130.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|