C9H7ClF3N — CID 11775698
2,2,2-trifluoro-N-(4-methylphenyl)ethanimidoyl chloride (PubChem CID 11775698) has the molecular formula C9H7ClF3N and a molecular weight of 221.61 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(4-methylphenyl)ethanimidoyl chloride.
| Compound Name | 2,2,2-trifluoro-N-(4-methylphenyl)ethanimidoyl chloride |
|---|---|
| PubChem CID | 11775698 |
| Molecular Formula | C9H7ClF3N |
| Molecular Weight | 221.61 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | 2,2,2-trifluoro-N-(4-methylphenyl)ethanimidoyl chloride |
| SMILES | Cc1ccc(/N=C(\Cl)C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H7ClF3N/c1-6-2-4-7(5-3-6)14-8(10)9(11,12)13/h2-5H,1H3/b14-8- |
| InChIKey | QXTZFTFJNQVVKJ-ZSOIEALJSA-N |
| XLogP | 3.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|