C11H7N5O — CID 11775830
13-methyl-12-oxido-2,6,7-triaza-12-azoniatricyclo[7.4.0.03,7]trideca-1,3,5,8,10,12-hexaene-4-carbonitrile (PubChem CID 11775830) has the molecular formula C11H7N5O and a molecular weight of 225.21 g/mol. Its IUPAC name is 13-methyl-12-oxido-2,6,7-triaza-12-azoniatricyclo[7.4.0.03,7]trideca-1,3,5,8,10,12-hexaene-4-carbonitrile.
| Compound Name | 13-methyl-12-oxido-2,6,7-triaza-12-azoniatricyclo[7.4.0.03,7]trideca-1,3,5,8,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 11775830 |
| Molecular Formula | C11H7N5O |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 13-methyl-12-oxido-2,6,7-triaza-12-azoniatricyclo[7.4.0.03,7]trideca-1,3,5,8,10,12-hexaene-4-carbonitrile |
| SMILES | Cc1c2nc3c(C#N)cnn3cc2cc[n+]1[O-] |
| InChI | InChI=1S/C11H7N5O/c1-7-10-8(2-3-16(7)17)6-15-11(14-10)9(4-12)5-13-15/h2-3,5-6H,1H3 |
| InChIKey | RAAIKURCFYUWOR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|