C12H11FN2O2 — CID 11776187
(5Z,7E,9Z)-7-fluoro-1,3-dimethylcycloocta[d]pyrimidine-2,4-dione (PubChem CID 11776187) has the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. Its IUPAC name is (5Z,7E,9Z)-7-fluoro-1,3-dimethylcycloocta[d]pyrimidine-2,4-dione.
| Compound Name | (5Z,7E,9Z)-7-fluoro-1,3-dimethylcycloocta[d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11776187 |
| Molecular Formula | C12H11FN2O2 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | (5Z,7E,9Z)-7-fluoro-1,3-dimethylcycloocta[d]pyrimidine-2,4-dione |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)/C=C\C(F)=C/C=C\2 |
| InChI | InChI=1S/C12H11FN2O2/c1-14-10-5-3-4-8(13)6-7-9(10)11(16)15(2)12(14)17/h3-7H,1-2H3/b4-3-,5-3-,7-6-,8-4+,8-6+,9-7+,10-5+ |
| InChIKey | PADVRIWDUMRBCR-QVFLREDRSA-N |
| XLogP | 0.98 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |