C13H19NO3 — CID 11776311
4-(2-methoxyethoxy)-1-oxido-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-1-ium (PubChem CID 11776311) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-1-oxido-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-1-ium.
| Compound Name | 4-(2-methoxyethoxy)-1-oxido-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-1-ium |
|---|---|
| PubChem CID | 11776311 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 4-(2-methoxyethoxy)-1-oxido-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-1-ium |
| SMILES | COCCOc1cc[n+]([O-])c2c1CCCCC2 |
| InChI | InChI=1S/C13H19NO3/c1-16-9-10-17-13-7-8-14(15)12-6-4-2-3-5-11(12)13/h7-8H,2-6,9-10H2,1H3 |
| InChIKey | JCERMDSOVQBDJM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|