About 8-(thian-4-ylidene)-1,4-dioxaspiro[4.5]decane
8-(thian-4-ylidene)-1,4-dioxaspiro[4.5]decane (PubChem CID 11776456) has the molecular formula C13H20O2S
and a molecular weight of 240.37 g/mol. Its IUPAC name is 8-(thian-4-ylidene)-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-(thian-4-ylidene)-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 11776456 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 8-(thian-4-ylidene)-1,4-dioxaspiro[4.5]decane |
| SMILES | C1COC2(CCC(=C3CCSCC3)CC2)O1 |
| InChI | InChI=1S/C13H20O2S/c1-5-13(14-7-8-15-13)6-2-11(1)12-3-9-16-10-4-12/h1-10H2 |
| InChIKey | FQPRGHGVDLAYBB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-(thian-4-ylidene)-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(thian-4-ylidene)-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 8-(thian-4-ylidene)-1,4-dioxaspiro[4.5]decane (CID 11776456) is 8-(thian-4-ylidene)-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 8-(thian-4-ylidene)-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 8-(thian-4-ylidene)-1,4-dioxaspiro[4.5]decane is C1COC2(CCC(=C3CCSCC3)CC2)O1.
What is the InChIKey of 8-(thian-4-ylidene)-1,4-dioxaspiro[4.5]decane?
The InChIKey is FQPRGHGVDLAYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2S/c1-5-13(14-7-8-15-13)6-2-11(1)12-3-9-16-10-4-12/h1-10H2.
What are the key properties of 8-(thian-4-ylidene)-1,4-dioxaspiro[4.5]decane?
8-(thian-4-ylidene)-1,4-dioxaspiro[4.5]decane has a molecular weight of 240.37 g/mol, XLogP of 3.13, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(thian-4-ylidene)-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 11776456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).