About 6-ethylsulfanyl-9-methyl-1,2,3,4-tetrahydrocarbazole
6-ethylsulfanyl-9-methyl-1,2,3,4-tetrahydrocarbazole (PubChem CID 11776645) has the molecular formula C15H19NS
and a molecular weight of 245.39 g/mol. Its IUPAC name is 6-ethylsulfanyl-9-methyl-1,2,3,4-tetrahydrocarbazole.
Molecular Properties
| Compound Name | 6-ethylsulfanyl-9-methyl-1,2,3,4-tetrahydrocarbazole |
| PubChem CID | 11776645 |
| Molecular Formula | C15H19NS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 6-ethylsulfanyl-9-methyl-1,2,3,4-tetrahydrocarbazole |
| SMILES | CCSc1ccc2c(c1)c1c(n2C)CCCC1 |
| InChI | InChI=1S/C15H19NS/c1-3-17-11-8-9-15-13(10-11)12-6-4-5-7-14(12)16(15)2/h8-10H,3-7H2,1-2H3 |
| InChIKey | WKODHJKBOVYZSE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 6-ethylsulfanyl-9-methyl-1,2,3,4-tetrahydrocarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethylsulfanyl-9-methyl-1,2,3,4-tetrahydrocarbazole?
The IUPAC name of 6-ethylsulfanyl-9-methyl-1,2,3,4-tetrahydrocarbazole (CID 11776645) is 6-ethylsulfanyl-9-methyl-1,2,3,4-tetrahydrocarbazole.
What is the SMILES notation for 6-ethylsulfanyl-9-methyl-1,2,3,4-tetrahydrocarbazole?
The canonical SMILES for 6-ethylsulfanyl-9-methyl-1,2,3,4-tetrahydrocarbazole is CCSc1ccc2c(c1)c1c(n2C)CCCC1.
What is the InChIKey of 6-ethylsulfanyl-9-methyl-1,2,3,4-tetrahydrocarbazole?
The InChIKey is WKODHJKBOVYZSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NS/c1-3-17-11-8-9-15-13(10-11)12-6-4-5-7-14(12)16(15)2/h8-10H,3-7H2,1-2H3.
What are the key properties of 6-ethylsulfanyl-9-methyl-1,2,3,4-tetrahydrocarbazole?
6-ethylsulfanyl-9-methyl-1,2,3,4-tetrahydrocarbazole has a molecular weight of 245.39 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethylsulfanyl-9-methyl-1,2,3,4-tetrahydrocarbazole is sourced from PubChem (CID 11776645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).