(2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid

C12H12N2O4 — CID 11776761

IUPAC(2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid
SMILESN[C@@H](Cc1c(-c2ccccc2)o[nH]c1=O)C(=O)O
InChIInChI=1S/C12H12N2O4/c13-9(12(16)17)6-8-10(18-14-11(8)15)7-4-2-1-3-5-7/h1-5,9H,6,13H2,(H,14,15)(H,16,17)/t9-/m0/s1
InChIKeyJCXLPVAAGYNKBT-VIFPVBQESA-N
MW248.24 g/mol
LogP0.59
Rot. Bonds4

About (2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid

(2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid (PubChem CID 11776761) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is (2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid.

Molecular Properties

Compound Name(2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid
PubChem CID11776761
Molecular FormulaC12H12N2O4
Molecular Weight248.24 g/mol
Exact Mass248.08
IUPAC Name(2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid
SMILESN[C@@H](Cc1c(-c2ccccc2)o[nH]c1=O)C(=O)O
InChIInChI=1S/C12H12N2O4/c13-9(12(16)17)6-8-10(18-14-11(8)15)7-4-2-1-3-5-7/h1-5,9H,6,13H2,(H,14,15)(H,16,17)/t9-/m0/s1
InChIKeyJCXLPVAAGYNKBT-VIFPVBQESA-N
XLogP0.59
TPSA109.32 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.24
LogP ≤ 50.59
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze (2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid?
The IUPAC name of (2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid (CID 11776761) is (2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid.
What is the SMILES notation for (2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid?
The canonical SMILES for (2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid is N[C@@H](Cc1c(-c2ccccc2)o[nH]c1=O)C(=O)O.
What is the InChIKey of (2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid?
The InChIKey is JCXLPVAAGYNKBT-VIFPVBQESA-N. The full InChI is InChI=1S/C12H12N2O4/c13-9(12(16)17)6-8-10(18-14-11(8)15)7-4-2-1-3-5-7/h1-5,9H,6,13H2,(H,14,15)(H,16,17)/t9-/m0/s1.
What are the key properties of (2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid?
(2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid has a molecular weight of 248.24 g/mol, XLogP of 0.59, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-(3-oxo-5-phenyl-1,2-oxazol-4-yl)propanoic acid is sourced from PubChem (CID 11776761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).