C10H17ClN2OS — CID 11776807
1-(1,3,4,5-tetramethylimidazol-1-ium-2-yl)sulfanylpropan-2-one chloride (PubChem CID 11776807) has the molecular formula C10H17ClN2OS and a molecular weight of 248.78 g/mol. Its IUPAC name is 1-(1,3,4,5-tetramethylimidazol-1-ium-2-yl)sulfanylpropan-2-one chloride.
| Compound Name | 1-(1,3,4,5-tetramethylimidazol-1-ium-2-yl)sulfanylpropan-2-one chloride |
|---|---|
| PubChem CID | 11776807 |
| Molecular Formula | C10H17ClN2OS |
| Molecular Weight | 248.78 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1-(1,3,4,5-tetramethylimidazol-1-ium-2-yl)sulfanylpropan-2-one chloride |
| SMILES | CC(=O)CSc1n(C)c(C)c(C)[n+]1C.[Cl-] |
| InChI | InChI=1S/C10H17N2OS.ClH/c1-7(13)6-14-10-11(4)8(2)9(3)12(10)5;/h6H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | YWTXHMSMJQIXSG-UHFFFAOYSA-M |
| XLogP | -1.85 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.78 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|