C15H23NO2 — CID 11776842
(1R,2R)-2-methyl-3-(1-oxidopyrrolidin-1-ium-1-yl)-1-phenylbutan-1-ol (PubChem CID 11776842) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (1R,2R)-2-methyl-3-(1-oxidopyrrolidin-1-ium-1-yl)-1-phenylbutan-1-ol.
| Compound Name | (1R,2R)-2-methyl-3-(1-oxidopyrrolidin-1-ium-1-yl)-1-phenylbutan-1-ol |
|---|---|
| PubChem CID | 11776842 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (1R,2R)-2-methyl-3-(1-oxidopyrrolidin-1-ium-1-yl)-1-phenylbutan-1-ol |
| SMILES | CC([C@@H](C)[C@@H](O)c1ccccc1)[N+]1([O-])CCCC1 |
| InChI | InChI=1S/C15H23NO2/c1-12(13(2)16(18)10-6-7-11-16)15(17)14-8-4-3-5-9-14/h3-5,8-9,12-13,15,17H,6-7,10-11H2,1-2H3/t12-,13?,15-/m1/s1 |
| InChIKey | URYTVKVVHZTUPU-ILWWEHDPSA-N |
| XLogP | 2.85 |
| TPSA | 43.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|