About 6-anilinoquinazoline-5,8-dione
6-anilinoquinazoline-5,8-dione (PubChem CID 11776927) has the molecular formula C14H9N3O2
and a molecular weight of 251.25 g/mol. Its IUPAC name is 6-anilinoquinazoline-5,8-dione.
Molecular Properties
| Compound Name | 6-anilinoquinazoline-5,8-dione |
| PubChem CID | 11776927 |
| Molecular Formula | C14H9N3O2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 6-anilinoquinazoline-5,8-dione |
| SMILES | O=C1C(Nc2ccccc2)=CC(=O)c2ncncc21 |
| InChI | InChI=1S/C14H9N3O2/c18-12-6-11(17-9-4-2-1-3-5-9)14(19)10-7-15-8-16-13(10)12/h1-8,17H |
| InChIKey | GKJHAQRXFWAHLL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 6-anilinoquinazoline-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-anilinoquinazoline-5,8-dione?
The IUPAC name of 6-anilinoquinazoline-5,8-dione (CID 11776927) is 6-anilinoquinazoline-5,8-dione.
What is the SMILES notation for 6-anilinoquinazoline-5,8-dione?
The canonical SMILES for 6-anilinoquinazoline-5,8-dione is O=C1C(Nc2ccccc2)=CC(=O)c2ncncc21.
What is the InChIKey of 6-anilinoquinazoline-5,8-dione?
The InChIKey is GKJHAQRXFWAHLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O2/c18-12-6-11(17-9-4-2-1-3-5-9)14(19)10-7-15-8-16-13(10)12/h1-8,17H.
What are the key properties of 6-anilinoquinazoline-5,8-dione?
6-anilinoquinazoline-5,8-dione has a molecular weight of 251.25 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-anilinoquinazoline-5,8-dione is sourced from PubChem (CID 11776927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).