C16H17N3 — CID 11776952
6-benzyl-3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 11776952) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 6-benzyl-3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 6-benzyl-3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 11776952 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 6-benzyl-3-propan-2-yl-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CC(C)c1nnc2ccc(Cc3ccccc3)cn12 |
| InChI | InChI=1S/C16H17N3/c1-12(2)16-18-17-15-9-8-14(11-19(15)16)10-13-6-4-3-5-7-13/h3-9,11-12H,10H2,1-2H3 |
| InChIKey | CCHDWFZTASWCMH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |