About 2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanamine
2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanamine (PubChem CID 11777099) has the molecular formula C10H14N4S2
and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanamine |
| PubChem CID | 11777099 |
| Molecular Formula | C10H14N4S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanamine |
| SMILES | NCCc1nc(-c2csc(CCN)n2)cs1 |
| InChI | InChI=1S/C10H14N4S2/c11-3-1-9-13-7(5-15-9)8-6-16-10(14-8)2-4-12/h5-6H,1-4,11-12H2 |
| InChIKey | IACFBSSJUCYUPB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanamine?
The IUPAC name of 2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanamine (CID 11777099) is 2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanamine.
What is the SMILES notation for 2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanamine?
The canonical SMILES for 2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanamine is NCCc1nc(-c2csc(CCN)n2)cs1.
What is the InChIKey of 2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanamine?
The InChIKey is IACFBSSJUCYUPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4S2/c11-3-1-9-13-7(5-15-9)8-6-16-10(14-8)2-4-12/h5-6H,1-4,11-12H2.
What are the key properties of 2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanamine?
2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanamine has a molecular weight of 254.38 g/mol, XLogP of 1.27, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(2-aminoethyl)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]ethanamine is sourced from PubChem (CID 11777099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).