C16H17NO2 — CID 11777130
(5S,7R)-7-amino-5-phenyl-5,6,7,8-tetrahydronaphthalene-2,3-diol (PubChem CID 11777130) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is (5S,7R)-7-amino-5-phenyl-5,6,7,8-tetrahydronaphthalene-2,3-diol.
| Compound Name | (5S,7R)-7-amino-5-phenyl-5,6,7,8-tetrahydronaphthalene-2,3-diol |
|---|---|
| PubChem CID | 11777130 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (5S,7R)-7-amino-5-phenyl-5,6,7,8-tetrahydronaphthalene-2,3-diol |
| SMILES | N[C@H]1Cc2cc(O)c(O)cc2[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C16H17NO2/c17-12-6-11-7-15(18)16(19)9-14(11)13(8-12)10-4-2-1-3-5-10/h1-5,7,9,12-13,18-19H,6,8,17H2/t12-,13-/m0/s1 |
| InChIKey | SSUNCBAILFPJRJ-STQMWFEESA-N |
| XLogP | 2.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|