C17H24N2 — CID 11777192
2-hexyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 11777192) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-hexyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-hexyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 11777192 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2-hexyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCCCCCN1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C17H24N2/c1-2-3-4-7-11-19-12-10-15-14-8-5-6-9-16(14)18-17(15)13-19/h5-6,8-9,18H,2-4,7,10-13H2,1H3 |
| InChIKey | KPCSIFKEHSAAOK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|