About [(1S,6R)-6-azido-2-oxocyclohex-3-en-1-yl] benzoate
[(1S,6R)-6-azido-2-oxocyclohex-3-en-1-yl] benzoate (PubChem CID 11777213) has the molecular formula C13H11N3O3
and a molecular weight of 257.25 g/mol. Its IUPAC name is [(1S,6R)-6-azido-2-oxocyclohex-3-en-1-yl] benzoate.
Molecular Properties
| Compound Name | [(1S,6R)-6-azido-2-oxocyclohex-3-en-1-yl] benzoate |
| PubChem CID | 11777213 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | [(1S,6R)-6-azido-2-oxocyclohex-3-en-1-yl] benzoate |
| SMILES | [N-]=[N+]=N[C@@H]1CC=CC(=O)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H11N3O3/c14-16-15-10-7-4-8-11(17)12(10)19-13(18)9-5-2-1-3-6-9/h1-6,8,10,12H,7H2/t10-,12+/m1/s1 |
| InChIKey | UQPBBUXBHYRSRM-PWSUYJOCSA-N |
| XLogP | 2.42 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [(1S,6R)-6-azido-2-oxocyclohex-3-en-1-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,6R)-6-azido-2-oxocyclohex-3-en-1-yl] benzoate?
The IUPAC name of [(1S,6R)-6-azido-2-oxocyclohex-3-en-1-yl] benzoate (CID 11777213) is [(1S,6R)-6-azido-2-oxocyclohex-3-en-1-yl] benzoate.
What is the SMILES notation for [(1S,6R)-6-azido-2-oxocyclohex-3-en-1-yl] benzoate?
The canonical SMILES for [(1S,6R)-6-azido-2-oxocyclohex-3-en-1-yl] benzoate is [N-]=[N+]=N[C@@H]1CC=CC(=O)[C@H]1OC(=O)c1ccccc1.
What is the InChIKey of [(1S,6R)-6-azido-2-oxocyclohex-3-en-1-yl] benzoate?
The InChIKey is UQPBBUXBHYRSRM-PWSUYJOCSA-N. The full InChI is InChI=1S/C13H11N3O3/c14-16-15-10-7-4-8-11(17)12(10)19-13(18)9-5-2-1-3-6-9/h1-6,8,10,12H,7H2/t10-,12+/m1/s1.
What are the key properties of [(1S,6R)-6-azido-2-oxocyclohex-3-en-1-yl] benzoate?
[(1S,6R)-6-azido-2-oxocyclohex-3-en-1-yl] benzoate has a molecular weight of 257.25 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,6R)-6-azido-2-oxocyclohex-3-en-1-yl] benzoate is sourced from PubChem (CID 11777213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).