C12H19NO5 — CID 11777218
N-(3,3,6,6-tetramethoxycyclohexa-1,4-dien-1-yl)acetamide (PubChem CID 11777218) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is N-(3,3,6,6-tetramethoxycyclohexa-1,4-dien-1-yl)acetamide.
| Compound Name | N-(3,3,6,6-tetramethoxycyclohexa-1,4-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 11777218 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N-(3,3,6,6-tetramethoxycyclohexa-1,4-dien-1-yl)acetamide |
| SMILES | COC1(OC)C=CC(OC)(OC)C(NC(C)=O)=C1 |
| InChI | InChI=1S/C12H19NO5/c1-9(14)13-10-8-11(15-2,16-3)6-7-12(10,17-4)18-5/h6-8H,1-5H3,(H,13,14) |
| InChIKey | TVBGPXBRXZZYBZ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|