About 3,4-dimethyl-1-(thiophen-2-ylmethyl)pyrano[3,2-d]pyrazol-6-one
3,4-dimethyl-1-(thiophen-2-ylmethyl)pyrano[3,2-d]pyrazol-6-one (PubChem CID 11777385) has the molecular formula C13H12N2O2S
and a molecular weight of 260.32 g/mol. Its IUPAC name is 3,4-dimethyl-1-(thiophen-2-ylmethyl)pyrano[3,2-d]pyrazol-6-one.
Molecular Properties
| Compound Name | 3,4-dimethyl-1-(thiophen-2-ylmethyl)pyrano[3,2-d]pyrazol-6-one |
| PubChem CID | 11777385 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 3,4-dimethyl-1-(thiophen-2-ylmethyl)pyrano[3,2-d]pyrazol-6-one |
| SMILES | Cc1cc(=O)oc2c1c(C)nn2Cc1cccs1 |
| InChI | InChI=1S/C13H12N2O2S/c1-8-6-11(16)17-13-12(8)9(2)14-15(13)7-10-4-3-5-18-10/h3-6H,7H2,1-2H3 |
| InChIKey | FMJZVTUXIGROSD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,4-dimethyl-1-(thiophen-2-ylmethyl)pyrano[3,2-d]pyrazol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-1-(thiophen-2-ylmethyl)pyrano[3,2-d]pyrazol-6-one?
The IUPAC name of 3,4-dimethyl-1-(thiophen-2-ylmethyl)pyrano[3,2-d]pyrazol-6-one (CID 11777385) is 3,4-dimethyl-1-(thiophen-2-ylmethyl)pyrano[3,2-d]pyrazol-6-one.
What is the SMILES notation for 3,4-dimethyl-1-(thiophen-2-ylmethyl)pyrano[3,2-d]pyrazol-6-one?
The canonical SMILES for 3,4-dimethyl-1-(thiophen-2-ylmethyl)pyrano[3,2-d]pyrazol-6-one is Cc1cc(=O)oc2c1c(C)nn2Cc1cccs1.
What is the InChIKey of 3,4-dimethyl-1-(thiophen-2-ylmethyl)pyrano[3,2-d]pyrazol-6-one?
The InChIKey is FMJZVTUXIGROSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2S/c1-8-6-11(16)17-13-12(8)9(2)14-15(13)7-10-4-3-5-18-10/h3-6H,7H2,1-2H3.
What are the key properties of 3,4-dimethyl-1-(thiophen-2-ylmethyl)pyrano[3,2-d]pyrazol-6-one?
3,4-dimethyl-1-(thiophen-2-ylmethyl)pyrano[3,2-d]pyrazol-6-one has a molecular weight of 260.32 g/mol, XLogP of 2.72, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-1-(thiophen-2-ylmethyl)pyrano[3,2-d]pyrazol-6-one is sourced from PubChem (CID 11777385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).