C12H14N4O3 — CID 11777474
methyl (10S)-5-methyl-2-oxo-1,4,5,8-tetrazatricyclo[8.3.0.03,7]trideca-3,6,8-triene-6-carboxylate (PubChem CID 11777474) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is methyl (10S)-5-methyl-2-oxo-1,4,5,8-tetrazatricyclo[8.3.0.03,7]trideca-3,6,8-triene-6-carboxylate.
| Compound Name | methyl (10S)-5-methyl-2-oxo-1,4,5,8-tetrazatricyclo[8.3.0.03,7]trideca-3,6,8-triene-6-carboxylate |
|---|---|
| PubChem CID | 11777474 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | methyl (10S)-5-methyl-2-oxo-1,4,5,8-tetrazatricyclo[8.3.0.03,7]trideca-3,6,8-triene-6-carboxylate |
| SMILES | COC(=O)c1c2c(nn1C)C(=O)N1CCC[C@H]1C=N2 |
| InChI | InChI=1S/C12H14N4O3/c1-15-10(12(18)19-2)8-9(14-15)11(17)16-5-3-4-7(16)6-13-8/h6-7H,3-5H2,1-2H3/t7-/m0/s1 |
| InChIKey | LEMGYBNAWMFPOA-ZETCQYMHSA-N |
| XLogP | 0.53 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |