C10H17BrO3 — CID 11777608
(3R,4S,5S)-5-(2-bromo-1-hydroxybutan-2-yl)-3,4-dimethyloxolan-2-one (PubChem CID 11777608) has the molecular formula C10H17BrO3 and a molecular weight of 265.15 g/mol. Its IUPAC name is (3R,4S,5S)-5-(2-bromo-1-hydroxybutan-2-yl)-3,4-dimethyloxolan-2-one.
| Compound Name | (3R,4S,5S)-5-(2-bromo-1-hydroxybutan-2-yl)-3,4-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 11777608 |
| Molecular Formula | C10H17BrO3 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | (3R,4S,5S)-5-(2-bromo-1-hydroxybutan-2-yl)-3,4-dimethyloxolan-2-one |
| SMILES | CCC(Br)(CO)[C@H]1OC(=O)[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C10H17BrO3/c1-4-10(11,5-12)8-6(2)7(3)9(13)14-8/h6-8,12H,4-5H2,1-3H3/t6-,7+,8-,10?/m0/s1 |
| InChIKey | BEHKVAGAGAIUIE-UYVBYVPASA-N |
| XLogP | 1.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|