About N'-(3-ethylphenyl)-2,3-dihydroindole-1-carboximidamide
N'-(3-ethylphenyl)-2,3-dihydroindole-1-carboximidamide (PubChem CID 11777643) has the molecular formula C17H19N3
and a molecular weight of 265.36 g/mol. Its IUPAC name is N'-(3-ethylphenyl)-2,3-dihydroindole-1-carboximidamide.
Molecular Properties
| Compound Name | N'-(3-ethylphenyl)-2,3-dihydroindole-1-carboximidamide |
| PubChem CID | 11777643 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | N'-(3-ethylphenyl)-2,3-dihydroindole-1-carboximidamide |
| SMILES | CCc1cccc(/N=C(\N)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C17H19N3/c1-2-13-6-5-8-15(12-13)19-17(18)20-11-10-14-7-3-4-9-16(14)20/h3-9,12H,2,10-11H2,1H3,(H2,18,19) |
| InChIKey | OUKIBIYFTGZAPH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-ethylphenyl)-2,3-dihydroindole-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-ethylphenyl)-2,3-dihydroindole-1-carboximidamide?
The IUPAC name of N'-(3-ethylphenyl)-2,3-dihydroindole-1-carboximidamide (CID 11777643) is N'-(3-ethylphenyl)-2,3-dihydroindole-1-carboximidamide.
What is the SMILES notation for N'-(3-ethylphenyl)-2,3-dihydroindole-1-carboximidamide?
The canonical SMILES for N'-(3-ethylphenyl)-2,3-dihydroindole-1-carboximidamide is CCc1cccc(/N=C(\N)N2CCc3ccccc32)c1.
What is the InChIKey of N'-(3-ethylphenyl)-2,3-dihydroindole-1-carboximidamide?
The InChIKey is OUKIBIYFTGZAPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3/c1-2-13-6-5-8-15(12-13)19-17(18)20-11-10-14-7-3-4-9-16(14)20/h3-9,12H,2,10-11H2,1H3,(H2,18,19).
What are the key properties of N'-(3-ethylphenyl)-2,3-dihydroindole-1-carboximidamide?
N'-(3-ethylphenyl)-2,3-dihydroindole-1-carboximidamide has a molecular weight of 265.36 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-ethylphenyl)-2,3-dihydroindole-1-carboximidamide is sourced from PubChem (CID 11777643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).