C17H22N2O — CID 11777934
(3aR,9bS)-3-(cyclopropylmethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-9-carboxamide (PubChem CID 11777934) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (3aR,9bS)-3-(cyclopropylmethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-9-carboxamide.
| Compound Name | (3aR,9bS)-3-(cyclopropylmethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-9-carboxamide |
|---|---|
| PubChem CID | 11777934 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (3aR,9bS)-3-(cyclopropylmethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-9-carboxamide |
| SMILES | NC(=O)c1cccc2c1[C@@H]1CCN(CC3CC3)[C@@H]1CC2 |
| InChI | InChI=1S/C17H22N2O/c18-17(20)14-3-1-2-12-6-7-15-13(16(12)14)8-9-19(15)10-11-4-5-11/h1-3,11,13,15H,4-10H2,(H2,18,20)/t13-,15-/m1/s1 |
| InChIKey | JXYMYIOBDAVBFP-UKRRQHHQSA-N |
| XLogP | 2.30 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |