About [(2R,3R)-2,3-dihydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate
[(2R,3R)-2,3-dihydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate (PubChem CID 11778006) has the molecular formula C13H20O6
and a molecular weight of 272.30 g/mol. Its IUPAC name is [(2R,3R)-2,3-dihydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate.
Molecular Properties
| Compound Name | [(2R,3R)-2,3-dihydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate |
| PubChem CID | 11778006 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | [(2R,3R)-2,3-dihydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate |
| SMILES | CCCCCC(=O)OC[C@@H](O)[C@H](O)C1=CC(=O)OC1 |
| InChI | InChI=1S/C13H20O6/c1-2-3-4-5-11(15)19-8-10(14)13(17)9-6-12(16)18-7-9/h6,10,13-14,17H,2-5,7-8H2,1H3/t10-,13-/m1/s1 |
| InChIKey | OSCLZPCUGNFFGD-ZWNOBZJWSA-N |
| XLogP | 0.31 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3R)-2,3-dihydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-2,3-dihydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate?
The IUPAC name of [(2R,3R)-2,3-dihydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate (CID 11778006) is [(2R,3R)-2,3-dihydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate.
What is the SMILES notation for [(2R,3R)-2,3-dihydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate?
The canonical SMILES for [(2R,3R)-2,3-dihydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate is CCCCCC(=O)OC[C@@H](O)[C@H](O)C1=CC(=O)OC1.
What is the InChIKey of [(2R,3R)-2,3-dihydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate?
The InChIKey is OSCLZPCUGNFFGD-ZWNOBZJWSA-N. The full InChI is InChI=1S/C13H20O6/c1-2-3-4-5-11(15)19-8-10(14)13(17)9-6-12(16)18-7-9/h6,10,13-14,17H,2-5,7-8H2,1H3/t10-,13-/m1/s1.
What are the key properties of [(2R,3R)-2,3-dihydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate?
[(2R,3R)-2,3-dihydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate has a molecular weight of 272.30 g/mol, XLogP of 0.31, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-2,3-dihydroxy-3-(5-oxo-2H-furan-3-yl)propyl] hexanoate is sourced from PubChem (CID 11778006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).