C7H8F9N — CID 11778243
3,3,4,4,5,5,6,6,6-nonafluoro-N-methylhexan-1-amine (PubChem CID 11778243) has the molecular formula C7H8F9N and a molecular weight of 277.13 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluoro-N-methylhexan-1-amine.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluoro-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 11778243 |
| Molecular Formula | C7H8F9N |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluoro-N-methylhexan-1-amine |
| SMILES | CNCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8F9N/c1-17-3-2-4(8,9)5(10,11)6(12,13)7(14,15)16/h17H,2-3H2,1H3 |
| InChIKey | YIEYDQIWFQKIOR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|