C14H16O6 — CID 11778393
dimethyl (1S,2S,3R,6S,7R,8R)-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylate (PubChem CID 11778393) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is dimethyl (1S,2S,3R,6S,7R,8R)-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylate.
| Compound Name | dimethyl (1S,2S,3R,6S,7R,8R)-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11778393 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | dimethyl (1S,2S,3R,6S,7R,8R)-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarboxylate |
| SMILES | COC(=O)C1C(C(=O)OC)[C@@H]2O[C@H]1[C@@H]1[C@H]2[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C14H16O6/c1-17-13(15)9-10(14(16)18-2)12-8-6-4-3-5(19-6)7(8)11(9)20-12/h3-12H,1-2H3/t5-,6+,7+,8-,9?,10?,11+,12- |
| InChIKey | WFKZXHODVMGXQU-JVAUBYOUSA-N |
| XLogP | -0.08 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|