C14H16N6O — CID 11778609
N-[(Z)-butan-2-ylideneamino]-2-(furan-2-yl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 11778609) has the molecular formula C14H16N6O and a molecular weight of 284.32 g/mol. Its IUPAC name is N-[(Z)-butan-2-ylideneamino]-2-(furan-2-yl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | N-[(Z)-butan-2-ylideneamino]-2-(furan-2-yl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 11778609 |
| Molecular Formula | C14H16N6O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | N-[(Z)-butan-2-ylideneamino]-2-(furan-2-yl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CC/C(C)=N\Nc1cc(C)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C14H16N6O/c1-4-9(2)17-18-12-8-10(3)15-14-16-13(19-20(12)14)11-6-5-7-21-11/h5-8,18H,4H2,1-3H3/b17-9- |
| InChIKey | FCCDCPGDCBBVJG-MFOYZWKCSA-N |
| XLogP | 2.89 |
| TPSA | 80.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|