C13H20O7 — CID 11778838
(1R,10S,11R,15R)-13,13-dimethyl-4,9,12,14,16-pentaoxatetracyclo[8.6.0.03,8.011,15]hexadecane-2,8-diol (PubChem CID 11778838) has the molecular formula C13H20O7 and a molecular weight of 288.30 g/mol. Its IUPAC name is (1R,10S,11R,15R)-13,13-dimethyl-4,9,12,14,16-pentaoxatetracyclo[8.6.0.03,8.011,15]hexadecane-2,8-diol.
| Compound Name | (1R,10S,11R,15R)-13,13-dimethyl-4,9,12,14,16-pentaoxatetracyclo[8.6.0.03,8.011,15]hexadecane-2,8-diol |
|---|---|
| PubChem CID | 11778838 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (1R,10S,11R,15R)-13,13-dimethyl-4,9,12,14,16-pentaoxatetracyclo[8.6.0.03,8.011,15]hexadecane-2,8-diol |
| SMILES | CC1(C)O[C@H]2O[C@@H]3C(O)C4OCCCC4(O)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C13H20O7/c1-12(2)18-9-8-7(17-11(9)20-12)6(14)10-13(15,19-8)4-3-5-16-10/h6-11,14-15H,3-5H2,1-2H3/t6?,7-,8+,9-,10?,11-,13?/m1/s1 |
| InChIKey | HTDOTQCFXZFAMV-KJSMIZATSA-N |
| XLogP | -0.51 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |