About N-[2-(1,5-dimethoxyindol-3-yl)ethyl]butanamide
N-[2-(1,5-dimethoxyindol-3-yl)ethyl]butanamide (PubChem CID 11778976) has the molecular formula C16H22N2O3
and a molecular weight of 290.36 g/mol. Its IUPAC name is N-[2-(1,5-dimethoxyindol-3-yl)ethyl]butanamide.
Molecular Properties
| Compound Name | N-[2-(1,5-dimethoxyindol-3-yl)ethyl]butanamide |
| PubChem CID | 11778976 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-[2-(1,5-dimethoxyindol-3-yl)ethyl]butanamide |
| SMILES | CCCC(=O)NCCc1cn(OC)c2ccc(OC)cc12 |
| InChI | InChI=1S/C16H22N2O3/c1-4-5-16(19)17-9-8-12-11-18(21-3)15-7-6-13(20-2)10-14(12)15/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,17,19) |
| InChIKey | IOIHIFQPSZMARF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(1,5-dimethoxyindol-3-yl)ethyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,5-dimethoxyindol-3-yl)ethyl]butanamide?
The IUPAC name of N-[2-(1,5-dimethoxyindol-3-yl)ethyl]butanamide (CID 11778976) is N-[2-(1,5-dimethoxyindol-3-yl)ethyl]butanamide.
What is the SMILES notation for N-[2-(1,5-dimethoxyindol-3-yl)ethyl]butanamide?
The canonical SMILES for N-[2-(1,5-dimethoxyindol-3-yl)ethyl]butanamide is CCCC(=O)NCCc1cn(OC)c2ccc(OC)cc12.
What is the InChIKey of N-[2-(1,5-dimethoxyindol-3-yl)ethyl]butanamide?
The InChIKey is IOIHIFQPSZMARF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O3/c1-4-5-16(19)17-9-8-12-11-18(21-3)15-7-6-13(20-2)10-14(12)15/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,17,19).
What are the key properties of N-[2-(1,5-dimethoxyindol-3-yl)ethyl]butanamide?
N-[2-(1,5-dimethoxyindol-3-yl)ethyl]butanamide has a molecular weight of 290.36 g/mol, XLogP of 2.17, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,5-dimethoxyindol-3-yl)ethyl]butanamide is sourced from PubChem (CID 11778976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).