C17H25NO3 — CID 11779056
1,1,3,3-tetramethyl-2-[(4-methyl-1,3-dioxan-2-yl)oxy]isoindole (PubChem CID 11779056) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[(4-methyl-1,3-dioxan-2-yl)oxy]isoindole.
| Compound Name | 1,1,3,3-tetramethyl-2-[(4-methyl-1,3-dioxan-2-yl)oxy]isoindole |
|---|---|
| PubChem CID | 11779056 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[(4-methyl-1,3-dioxan-2-yl)oxy]isoindole |
| SMILES | CC1CCOC(ON2C(C)(C)c3ccccc3C2(C)C)O1 |
| InChI | InChI=1S/C17H25NO3/c1-12-10-11-19-15(20-12)21-18-16(2,3)13-8-6-7-9-14(13)17(18,4)5/h6-9,12,15H,10-11H2,1-5H3 |
| InChIKey | WXPHESPYENDLBK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |