About 1-phenyl-5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole
1-phenyl-5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole (PubChem CID 11779129) has the molecular formula C20H24N2
and a molecular weight of 292.43 g/mol. Its IUPAC name is 1-phenyl-5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole.
Molecular Properties
| Compound Name | 1-phenyl-5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole |
| PubChem CID | 11779129 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 1-phenyl-5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole |
| SMILES | CC1=CCCC(C)(C)C1/C=C/c1ccnn1-c1ccccc1 |
| InChI | InChI=1S/C20H24N2/c1-16-8-7-14-20(2,3)19(16)12-11-18-13-15-21-22(18)17-9-5-4-6-10-17/h4-6,8-13,15,19H,7,14H2,1-3H3/b12-11+ |
| InChIKey | SBPUKXAKZOVQIO-VAWYXSNFSA-N |
| XLogP | 5.27 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole?
The IUPAC name of 1-phenyl-5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole (CID 11779129) is 1-phenyl-5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole.
What is the SMILES notation for 1-phenyl-5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole?
The canonical SMILES for 1-phenyl-5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole is CC1=CCCC(C)(C)C1/C=C/c1ccnn1-c1ccccc1.
What is the InChIKey of 1-phenyl-5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole?
The InChIKey is SBPUKXAKZOVQIO-VAWYXSNFSA-N. The full InChI is InChI=1S/C20H24N2/c1-16-8-7-14-20(2,3)19(16)12-11-18-13-15-21-22(18)17-9-5-4-6-10-17/h4-6,8-13,15,19H,7,14H2,1-3H3/b12-11+.
What are the key properties of 1-phenyl-5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole?
1-phenyl-5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole has a molecular weight of 292.43 g/mol, XLogP of 5.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-5-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]pyrazole is sourced from PubChem (CID 11779129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).