C6H10F3N3O3S2 — CID 11779153
(2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)methanethiol;trifluoromethanesulfonate (PubChem CID 11779153) has the molecular formula C6H10F3N3O3S2 and a molecular weight of 293.29 g/mol. Its IUPAC name is (2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)methanethiol;trifluoromethanesulfonate.
| Compound Name | (2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)methanethiol;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11779153 |
| Molecular Formula | C6H10F3N3O3S2 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | (2,4-dimethyl-1,2,4-triazol-4-ium-3-yl)methanethiol;trifluoromethanesulfonate |
| SMILES | Cn1nc[n+](C)c1CS.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C5H9N3S.CHF3O3S/c1-7-4-6-8(2)5(7)3-9;2-1(3,4)8(5,6)7/h4H,3H2,1-2H3;(H,5,6,7) |
| InChIKey | RYVHCQDYSIAQGB-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|