C15H23NO5 — CID 11779375
[(1S,6S,8aS)-6-(oxan-2-yloxy)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl] acetate (PubChem CID 11779375) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is [(1S,6S,8aS)-6-(oxan-2-yloxy)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl] acetate.
| Compound Name | [(1S,6S,8aS)-6-(oxan-2-yloxy)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl] acetate |
|---|---|
| PubChem CID | 11779375 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | [(1S,6S,8aS)-6-(oxan-2-yloxy)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC(=O)N2C[C@@H](OC3CCCCO3)CC[C@@H]12 |
| InChI | InChI=1S/C15H23NO5/c1-10(17)20-13-8-14(18)16-9-11(5-6-12(13)16)21-15-4-2-3-7-19-15/h11-13,15H,2-9H2,1H3/t11-,12-,13-,15?/m0/s1 |
| InChIKey | UMZGVZKAJHXYDP-BOEIJXPTSA-N |
| XLogP | 1.22 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |