C19H24O3 — CID 11779567
[(3S,8S,9Z)-8-hydroxyheptadeca-1,9,16-trien-4,6-diyn-3-yl] acetate (PubChem CID 11779567) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is [(3S,8S,9Z)-8-hydroxyheptadeca-1,9,16-trien-4,6-diyn-3-yl] acetate.
| Compound Name | [(3S,8S,9Z)-8-hydroxyheptadeca-1,9,16-trien-4,6-diyn-3-yl] acetate |
|---|---|
| PubChem CID | 11779567 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | [(3S,8S,9Z)-8-hydroxyheptadeca-1,9,16-trien-4,6-diyn-3-yl] acetate |
| SMILES | C=CCCCCC/C=C\[C@H](O)C#CC#C[C@H](C=C)OC(C)=O |
| InChI | InChI=1S/C19H24O3/c1-4-6-7-8-9-10-11-14-18(21)15-12-13-16-19(5-2)22-17(3)20/h4-5,11,14,18-19,21H,1-2,6-10H2,3H3/b14-11-/t18-,19-/m0/s1 |
| InChIKey | XLZZUDXEHSVXOR-ZUKORNFRSA-N |
| XLogP | 3.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|